ChemNet > CAS > 300665-23-0 (4-morpholino-3-nitrophenyl)methanol hydrochloride
300665-23-0 (4-morpholino-3-nitrophenyl)methanol hydrochloride
نام محصول |
(4-morpholino-3-nitrophenyl)methanol hydrochloride |
مترادف |
(4-morpholin-4-yl-3-nitrophenyl)methanol hydrochloride |
میدان مغناطیسی |
C11H15ClN2O4 |
وزن مولکولی |
274.7008 |
InChI |
InChI=1/C11H14N2O4.ClH/c14-8-9-1-2-10(11(7-9)13(15)16)12-3-5-17-6-4-12;/h1-2,7,14H,3-6,8H2;1H |
شماره سیایاس |
300665-23-0 |
ساختار مولکولی |
|
نقطه ذوب |
107℃ |
نقطه غلیان |
468.5°C at 760 mmHg |
نقطه اشتعال |
237.2°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|